C19H13NO4 — CID 137250269
7-hydroxy-4-methyl-6-(4-phenyl-1,2-oxazol-5-yl)chromen-2-one (PubChem CID 137250269) has the molecular formula C19H13NO4 and a molecular weight of 319.32 g/mol. Its IUPAC name is 7-hydroxy-4-methyl-6-(4-phenyl-1,2-oxazol-5-yl)chromen-2-one.
| Compound Name | 7-hydroxy-4-methyl-6-(4-phenyl-1,2-oxazol-5-yl)chromen-2-one |
|---|---|
| PubChem CID | 137250269 |
| Molecular Formula | C19H13NO4 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 7-hydroxy-4-methyl-6-(4-phenyl-1,2-oxazol-5-yl)chromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(O)c(-c3oncc3-c3ccccc3)cc12 |
| InChI | InChI=1S/C19H13NO4/c1-11-7-18(22)23-17-9-16(21)14(8-13(11)17)19-15(10-20-24-19)12-5-3-2-4-6-12/h2-10,21H,1H3 |
| InChIKey | GZLPHHICNJMHLL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|