About sodium;hydride;7-hydroxy-4-methylchromen-2-one
sodium;hydride;7-hydroxy-4-methylchromen-2-one (PubChem CID 172995509) has the molecular formula C10H9NaO3
and a molecular weight of 200.17 g/mol. Its IUPAC name is sodium;hydride;7-hydroxy-4-methylchromen-2-one.
Molecular Properties
| Compound Name | sodium;hydride;7-hydroxy-4-methylchromen-2-one |
| PubChem CID | 172995509 |
| Molecular Formula | C10H9NaO3 |
| Molecular Weight | 200.17 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | sodium;hydride;7-hydroxy-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(O)ccc12.[H-].[Na+] |
| InChI | InChI=1S/C10H8O3.Na.H/c1-6-4-10(12)13-9-5-7(11)2-3-8(6)9;;/h2-5,11H,1H3;;/q;+1;-1 |
| InChIKey | UTRZBPSWWMKRGB-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.17 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;7-hydroxy-4-methylchromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;7-hydroxy-4-methylchromen-2-one?
The IUPAC name of sodium;hydride;7-hydroxy-4-methylchromen-2-one (CID 172995509) is sodium;hydride;7-hydroxy-4-methylchromen-2-one.
What is the SMILES notation for sodium;hydride;7-hydroxy-4-methylchromen-2-one?
The canonical SMILES for sodium;hydride;7-hydroxy-4-methylchromen-2-one is Cc1cc(=O)oc2cc(O)ccc12.[H-].[Na+].
What is the InChIKey of sodium;hydride;7-hydroxy-4-methylchromen-2-one?
The InChIKey is UTRZBPSWWMKRGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O3.Na.H/c1-6-4-10(12)13-9-5-7(11)2-3-8(6)9;;/h2-5,11H,1H3;;/q;+1;-1.
What are the key properties of sodium;hydride;7-hydroxy-4-methylchromen-2-one?
sodium;hydride;7-hydroxy-4-methylchromen-2-one has a molecular weight of 200.17 g/mol, XLogP of -1.08, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;7-hydroxy-4-methylchromen-2-one is sourced from PubChem (CID 172995509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).