About 7-hydroxy-4-methylchromen-2-one;methanesulfonic acid
7-hydroxy-4-methylchromen-2-one;methanesulfonic acid (PubChem CID 88677960) has the molecular formula C11H12O6S
and a molecular weight of 272.28 g/mol. Its IUPAC name is 7-hydroxy-4-methylchromen-2-one;methanesulfonic acid.
Molecular Properties
| Compound Name | 7-hydroxy-4-methylchromen-2-one;methanesulfonic acid |
| PubChem CID | 88677960 |
| Molecular Formula | C11H12O6S |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 7-hydroxy-4-methylchromen-2-one;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.Cc1cc(=O)oc2cc(O)ccc12 |
| InChI | InChI=1S/C10H8O3.CH4O3S/c1-6-4-10(12)13-9-5-7(11)2-3-8(6)9;1-5(2,3)4/h2-5,11H,1H3;1H3,(H,2,3,4) |
| InChIKey | IPISEXIREPQUOY-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 7-hydroxy-4-methylchromen-2-one;methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-4-methylchromen-2-one;methanesulfonic acid?
The IUPAC name of 7-hydroxy-4-methylchromen-2-one;methanesulfonic acid (CID 88677960) is 7-hydroxy-4-methylchromen-2-one;methanesulfonic acid.
What is the SMILES notation for 7-hydroxy-4-methylchromen-2-one;methanesulfonic acid?
The canonical SMILES for 7-hydroxy-4-methylchromen-2-one;methanesulfonic acid is CS(=O)(=O)O.Cc1cc(=O)oc2cc(O)ccc12.
What is the InChIKey of 7-hydroxy-4-methylchromen-2-one;methanesulfonic acid?
The InChIKey is IPISEXIREPQUOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O3.CH4O3S/c1-6-4-10(12)13-9-5-7(11)2-3-8(6)9;1-5(2,3)4/h2-5,11H,1H3;1H3,(H,2,3,4).
What are the key properties of 7-hydroxy-4-methylchromen-2-one;methanesulfonic acid?
7-hydroxy-4-methylchromen-2-one;methanesulfonic acid has a molecular weight of 272.28 g/mol, XLogP of 1.31, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-4-methylchromen-2-one;methanesulfonic acid is sourced from PubChem (CID 88677960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).