C16H8N4O3 — CID 18475292
ethene-1,1,2,2-tetracarbonitrile;7-hydroxy-4-methylchromen-2-one (PubChem CID 18475292) has the molecular formula C16H8N4O3 and a molecular weight of 304.27 g/mol. Its IUPAC name is ethene-1,1,2,2-tetracarbonitrile;7-hydroxy-4-methylchromen-2-one.
| Compound Name | ethene-1,1,2,2-tetracarbonitrile;7-hydroxy-4-methylchromen-2-one |
|---|---|
| PubChem CID | 18475292 |
| Molecular Formula | C16H8N4O3 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | ethene-1,1,2,2-tetracarbonitrile;7-hydroxy-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(O)ccc12.N#CC(C#N)=C(C#N)C#N |
| InChI | InChI=1S/C10H8O3.C6N4/c1-6-4-10(12)13-9-5-7(11)2-3-8(6)9;7-1-5(2-8)6(3-9)4-10/h2-5,11H,1H3; |
| InChIKey | SORBXTICKCTUNG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 145.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|