C15H18N2O6S — CID 174709823
2-[(2-amino-3-sulfanylpropanoyl)amino]acetic acid;7-hydroxy-4-methylchromen-2-one (PubChem CID 174709823) has the molecular formula C15H18N2O6S and a molecular weight of 354.38 g/mol. Its IUPAC name is 2-[(2-amino-3-sulfanylpropanoyl)amino]acetic acid;7-hydroxy-4-methylchromen-2-one.
| Compound Name | 2-[(2-amino-3-sulfanylpropanoyl)amino]acetic acid;7-hydroxy-4-methylchromen-2-one |
|---|---|
| PubChem CID | 174709823 |
| Molecular Formula | C15H18N2O6S |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 2-[(2-amino-3-sulfanylpropanoyl)amino]acetic acid;7-hydroxy-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(O)ccc12.NC(CS)C(=O)NCC(=O)O |
| InChI | InChI=1S/C10H8O3.C5H10N2O3S/c1-6-4-10(12)13-9-5-7(11)2-3-8(6)9;6-3(2-11)5(10)7-1-4(8)9/h2-5,11H,1H3;3,11H,1-2,6H2,(H,7,10)(H,8,9) |
| InChIKey | ADJGRVSLDVEONV-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 142.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|