C14H16N2O3S — CID 71774819
(2S)-2-amino-N-(4-methyl-2-oxochromen-7-yl)-4-sulfanylbutanamide (PubChem CID 71774819) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is (2S)-2-amino-N-(4-methyl-2-oxochromen-7-yl)-4-sulfanylbutanamide.
| Compound Name | (2S)-2-amino-N-(4-methyl-2-oxochromen-7-yl)-4-sulfanylbutanamide |
|---|---|
| PubChem CID | 71774819 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | (2S)-2-amino-N-(4-methyl-2-oxochromen-7-yl)-4-sulfanylbutanamide |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)[C@@H](N)CCS)ccc12 |
| InChI | InChI=1S/C14H16N2O3S/c1-8-6-13(17)19-12-7-9(2-3-10(8)12)16-14(18)11(15)4-5-20/h2-3,6-7,11,20H,4-5,15H2,1H3,(H,16,18)/t11-/m0/s1 |
| InChIKey | ZPZKELQERPUORO-NSHDSACASA-N |
| XLogP | 1.69 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|