C33H29N3O4 — CID 102005856
(2S)-2-amino-N-(4-methyl-2-oxochromen-7-yl)-N'-tritylbutanediamide (PubChem CID 102005856) has the molecular formula C33H29N3O4 and a molecular weight of 531.61 g/mol. Its IUPAC name is (2S)-2-amino-N-(4-methyl-2-oxochromen-7-yl)-N'-tritylbutanediamide.
| Compound Name | (2S)-2-amino-N-(4-methyl-2-oxochromen-7-yl)-N'-tritylbutanediamide |
|---|---|
| PubChem CID | 102005856 |
| Molecular Formula | C33H29N3O4 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | (2S)-2-amino-N-(4-methyl-2-oxochromen-7-yl)-N'-tritylbutanediamide |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)[C@@H](N)CC(=O)NC(c3ccccc3)(c3ccccc3)c3ccccc3)ccc12 |
| InChI | InChI=1S/C33H29N3O4/c1-22-19-31(38)40-29-20-26(17-18-27(22)29)35-32(39)28(34)21-30(37)36-33(23-11-5-2-6-12-23,24-13-7-3-8-14-24)25-15-9-4-10-16-25/h2-20,28H,21,34H2,1H3,(H,35,39)(H,36,37)/t28-/m0/s1 |
| InChIKey | RDJMBTHOOODOBV-NDEPHWFRSA-N |
| XLogP | 4.87 |
| TPSA | 114.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|