C21H21NO3 — CID 16551195
N-(4-methyl-2-oxochromen-7-yl)-2-phenylpentanamide (PubChem CID 16551195) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is N-(4-methyl-2-oxochromen-7-yl)-2-phenylpentanamide.
| Compound Name | N-(4-methyl-2-oxochromen-7-yl)-2-phenylpentanamide |
|---|---|
| PubChem CID | 16551195 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | N-(4-methyl-2-oxochromen-7-yl)-2-phenylpentanamide |
| SMILES | CCCC(C(=O)Nc1ccc2c(C)cc(=O)oc2c1)c1ccccc1 |
| InChI | InChI=1S/C21H21NO3/c1-3-7-18(15-8-5-4-6-9-15)21(24)22-16-10-11-17-14(2)12-20(23)25-19(17)13-16/h4-6,8-13,18H,3,7H2,1-2H3,(H,22,24) |
| InChIKey | INFZUFVDGCQFKI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|