C22H23N3O4 — CID 47072840
N,N-dimethyl-3-[(4-methyl-2-oxochromen-7-yl)carbamoylamino]-3-phenylpropanamide (PubChem CID 47072840) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is N,N-dimethyl-3-[(4-methyl-2-oxochromen-7-yl)carbamoylamino]-3-phenylpropanamide.
| Compound Name | N,N-dimethyl-3-[(4-methyl-2-oxochromen-7-yl)carbamoylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 47072840 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N,N-dimethyl-3-[(4-methyl-2-oxochromen-7-yl)carbamoylamino]-3-phenylpropanamide |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)NC(CC(=O)N(C)C)c3ccccc3)ccc12 |
| InChI | InChI=1S/C22H23N3O4/c1-14-11-21(27)29-19-12-16(9-10-17(14)19)23-22(28)24-18(13-20(26)25(2)3)15-7-5-4-6-8-15/h4-12,18H,13H2,1-3H3,(H2,23,24,28) |
| InChIKey | GRUCVMWKSFHHSR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|