C26H24N2O5S — CID 126341390
(3R)-N-(4-methyl-2-oxochromen-7-yl)-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide (PubChem CID 126341390) has the molecular formula C26H24N2O5S and a molecular weight of 476.55 g/mol. Its IUPAC name is (3R)-N-(4-methyl-2-oxochromen-7-yl)-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide.
| Compound Name | (3R)-N-(4-methyl-2-oxochromen-7-yl)-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 126341390 |
| Molecular Formula | C26H24N2O5S |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | (3R)-N-(4-methyl-2-oxochromen-7-yl)-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H](CC(=O)Nc2ccc3c(C)cc(=O)oc3c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H24N2O5S/c1-17-8-11-21(12-9-17)34(31,32)28-23(19-6-4-3-5-7-19)16-25(29)27-20-10-13-22-18(2)14-26(30)33-24(22)15-20/h3-15,23,28H,16H2,1-2H3,(H,27,29)/t23-/m1/s1 |
| InChIKey | KOXSPTRLWYIWQU-HSZRJFAPSA-N |
| XLogP | 4.46 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|