C18H18N2O8 — CID 102186404
(3R)-3-(3-carboxypropanoylamino)-4-[(4-methyl-2-oxochromen-7-yl)amino]-4-oxobutanoic acid (PubChem CID 102186404) has the molecular formula C18H18N2O8 and a molecular weight of 390.35 g/mol. Its IUPAC name is (3R)-3-(3-carboxypropanoylamino)-4-[(4-methyl-2-oxochromen-7-yl)amino]-4-oxobutanoic acid.
| Compound Name | (3R)-3-(3-carboxypropanoylamino)-4-[(4-methyl-2-oxochromen-7-yl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 102186404 |
| Molecular Formula | C18H18N2O8 |
| Molecular Weight | 390.35 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | (3R)-3-(3-carboxypropanoylamino)-4-[(4-methyl-2-oxochromen-7-yl)amino]-4-oxobutanoic acid |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)[C@@H](CC(=O)O)NC(=O)CCC(=O)O)ccc12 |
| InChI | InChI=1S/C18H18N2O8/c1-9-6-17(26)28-13-7-10(2-3-11(9)13)19-18(27)12(8-16(24)25)20-14(21)4-5-15(22)23/h2-3,6-7,12H,4-5,8H2,1H3,(H,19,27)(H,20,21)(H,22,23)(H,24,25)/t12-/m1/s1 |
| InChIKey | LWBYOWDYXXNJKF-GFCCVEGCSA-N |
| XLogP | 0.86 |
| TPSA | 163.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.35 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|