C26H37N5O7 — CID 112758124
tert-butyl N-[N'-[(4S)-4-amino-5-[(4-methyl-2-oxochromen-7-yl)amino]-5-oxopentyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate (PubChem CID 112758124) has the molecular formula C26H37N5O7 and a molecular weight of 531.61 g/mol. Its IUPAC name is tert-butyl N-[N'-[(4S)-4-amino-5-[(4-methyl-2-oxochromen-7-yl)amino]-5-oxopentyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N'-[(4S)-4-amino-5-[(4-methyl-2-oxochromen-7-yl)amino]-5-oxopentyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 112758124 |
| Molecular Formula | C26H37N5O7 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | tert-butyl N-[N'-[(4S)-4-amino-5-[(4-methyl-2-oxochromen-7-yl)amino]-5-oxopentyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)[C@@H](N)CCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)ccc12 |
| InChI | InChI=1S/C26H37N5O7/c1-15-13-20(32)36-19-14-16(10-11-17(15)19)29-21(33)18(27)9-8-12-28-22(30-23(34)37-25(2,3)4)31-24(35)38-26(5,6)7/h10-11,13-14,18H,8-9,12,27H2,1-7H3,(H,29,33)(H2,28,30,31,34,35)/t18-/m0/s1 |
| InChIKey | TUBIJMCTIUBMPU-SFHVURJKSA-N |
| XLogP | 3.55 |
| TPSA | 174.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|