C16H22N2O4 — CID 87290425
7-amino-4-methylchromen-2-one;(2S)-2-amino-4-methylpentanoic acid (PubChem CID 87290425) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is 7-amino-4-methylchromen-2-one;(2S)-2-amino-4-methylpentanoic acid.
| Compound Name | 7-amino-4-methylchromen-2-one;(2S)-2-amino-4-methylpentanoic acid |
|---|---|
| PubChem CID | 87290425 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 7-amino-4-methylchromen-2-one;(2S)-2-amino-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](N)C(=O)O.Cc1cc(=O)oc2cc(N)ccc12 |
| InChI | InChI=1S/C10H9NO2.C6H13NO2/c1-6-4-10(12)13-9-5-7(11)2-3-8(6)9;1-4(2)3-5(7)6(8)9/h2-5H,11H2,1H3;4-5H,3,7H2,1-2H3,(H,8,9)/t;5-/m.0/s1 |
| InChIKey | IWFAIEVZVGTOHS-ZSCHJXSPSA-N |
| XLogP | 2.13 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|