7-amino-4-methylchromen-2-one;formyl chloride

C11H10ClNO3 — CID 175535632

IUPAC7-amino-4-methylchromen-2-one;formyl chloride
SMILESCc1cc(=O)oc2cc(N)ccc12.O=CCl
InChIInChI=1S/C10H9NO2.CHClO/c1-6-4-10(12)13-9-5-7(11)2-3-8(6)9;2-1-3/h2-5H,11H2,1H3;1H
InChIKeyLHHPGOOBQYDQDV-UHFFFAOYSA-N
MW239.66 g/mol
LogP2.10
Rot. Bonds

About 7-amino-4-methylchromen-2-one;formyl chloride

7-amino-4-methylchromen-2-one;formyl chloride (PubChem CID 175535632) has the molecular formula C11H10ClNO3 and a molecular weight of 239.66 g/mol. Its IUPAC name is 7-amino-4-methylchromen-2-one;formyl chloride.

Molecular Properties

Compound Name7-amino-4-methylchromen-2-one;formyl chloride
PubChem CID175535632
Molecular FormulaC11H10ClNO3
Molecular Weight239.66 g/mol
Exact Mass239.03
IUPAC Name7-amino-4-methylchromen-2-one;formyl chloride
SMILESCc1cc(=O)oc2cc(N)ccc12.O=CCl
InChIInChI=1S/C10H9NO2.CHClO/c1-6-4-10(12)13-9-5-7(11)2-3-8(6)9;2-1-3/h2-5H,11H2,1H3;1H
InChIKeyLHHPGOOBQYDQDV-UHFFFAOYSA-N
XLogP2.10
TPSA73.30 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.66
LogP ≤ 52.10
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}

Analyze 7-amino-4-methylchromen-2-one;formyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-amino-4-methylchromen-2-one;formyl chloride?
The IUPAC name of 7-amino-4-methylchromen-2-one;formyl chloride (CID 175535632) is 7-amino-4-methylchromen-2-one;formyl chloride.
What is the SMILES notation for 7-amino-4-methylchromen-2-one;formyl chloride?
The canonical SMILES for 7-amino-4-methylchromen-2-one;formyl chloride is Cc1cc(=O)oc2cc(N)ccc12.O=CCl.
What is the InChIKey of 7-amino-4-methylchromen-2-one;formyl chloride?
The InChIKey is LHHPGOOBQYDQDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2.CHClO/c1-6-4-10(12)13-9-5-7(11)2-3-8(6)9;2-1-3/h2-5H,11H2,1H3;1H.
What are the key properties of 7-amino-4-methylchromen-2-one;formyl chloride?
7-amino-4-methylchromen-2-one;formyl chloride has a molecular weight of 239.66 g/mol, XLogP of 2.10, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-4-methylchromen-2-one;formyl chloride is sourced from PubChem (CID 175535632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).