About 7-amino-4-methylchromen-2-one;formyl chloride
7-amino-4-methylchromen-2-one;formyl chloride (PubChem CID 175535632) has the molecular formula C11H10ClNO3
and a molecular weight of 239.66 g/mol. Its IUPAC name is 7-amino-4-methylchromen-2-one;formyl chloride.
Molecular Properties
| Compound Name | 7-amino-4-methylchromen-2-one;formyl chloride |
| PubChem CID | 175535632 |
| Molecular Formula | C11H10ClNO3 |
| Molecular Weight | 239.66 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 7-amino-4-methylchromen-2-one;formyl chloride |
| SMILES | Cc1cc(=O)oc2cc(N)ccc12.O=CCl |
| InChI | InChI=1S/C10H9NO2.CHClO/c1-6-4-10(12)13-9-5-7(11)2-3-8(6)9;2-1-3/h2-5H,11H2,1H3;1H |
| InChIKey | LHHPGOOBQYDQDV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.66 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 7-amino-4-methylchromen-2-one;formyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-4-methylchromen-2-one;formyl chloride?
The IUPAC name of 7-amino-4-methylchromen-2-one;formyl chloride (CID 175535632) is 7-amino-4-methylchromen-2-one;formyl chloride.
What is the SMILES notation for 7-amino-4-methylchromen-2-one;formyl chloride?
The canonical SMILES for 7-amino-4-methylchromen-2-one;formyl chloride is Cc1cc(=O)oc2cc(N)ccc12.O=CCl.
What is the InChIKey of 7-amino-4-methylchromen-2-one;formyl chloride?
The InChIKey is LHHPGOOBQYDQDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2.CHClO/c1-6-4-10(12)13-9-5-7(11)2-3-8(6)9;2-1-3/h2-5H,11H2,1H3;1H.
What are the key properties of 7-amino-4-methylchromen-2-one;formyl chloride?
7-amino-4-methylchromen-2-one;formyl chloride has a molecular weight of 239.66 g/mol, XLogP of 2.10, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-4-methylchromen-2-one;formyl chloride is sourced from PubChem (CID 175535632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).