About 2-aminoacetic acid;7-amino-4-methylchromen-2-one;hydrochloride
2-aminoacetic acid;7-amino-4-methylchromen-2-one;hydrochloride (PubChem CID 87630650) has the molecular formula C12H15ClN2O4
and a molecular weight of 286.72 g/mol. Its IUPAC name is 2-aminoacetic acid;7-amino-4-methylchromen-2-one;hydrochloride.
Molecular Properties
| Compound Name | 2-aminoacetic acid;7-amino-4-methylchromen-2-one;hydrochloride |
| PubChem CID | 87630650 |
| Molecular Formula | C12H15ClN2O4 |
| Molecular Weight | 286.72 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 2-aminoacetic acid;7-amino-4-methylchromen-2-one;hydrochloride |
| SMILES | Cc1cc(=O)oc2cc(N)ccc12.Cl.NCC(=O)O |
| InChI | InChI=1S/C10H9NO2.C2H5NO2.ClH/c1-6-4-10(12)13-9-5-7(11)2-3-8(6)9;3-1-2(4)5;/h2-5H,11H2,1H3;1,3H2,(H,4,5);1H |
| InChIKey | KRLSJAKONBUAQB-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.72 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoacetic acid;7-amino-4-methylchromen-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoacetic acid;7-amino-4-methylchromen-2-one;hydrochloride?
The IUPAC name of 2-aminoacetic acid;7-amino-4-methylchromen-2-one;hydrochloride (CID 87630650) is 2-aminoacetic acid;7-amino-4-methylchromen-2-one;hydrochloride.
What is the SMILES notation for 2-aminoacetic acid;7-amino-4-methylchromen-2-one;hydrochloride?
The canonical SMILES for 2-aminoacetic acid;7-amino-4-methylchromen-2-one;hydrochloride is Cc1cc(=O)oc2cc(N)ccc12.Cl.NCC(=O)O.
What is the InChIKey of 2-aminoacetic acid;7-amino-4-methylchromen-2-one;hydrochloride?
The InChIKey is KRLSJAKONBUAQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2.C2H5NO2.ClH/c1-6-4-10(12)13-9-5-7(11)2-3-8(6)9;3-1-2(4)5;/h2-5H,11H2,1H3;1,3H2,(H,4,5);1H.
What are the key properties of 2-aminoacetic acid;7-amino-4-methylchromen-2-one;hydrochloride?
2-aminoacetic acid;7-amino-4-methylchromen-2-one;hydrochloride has a molecular weight of 286.72 g/mol, XLogP of 1.14, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoacetic acid;7-amino-4-methylchromen-2-one;hydrochloride is sourced from PubChem (CID 87630650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).