C12H12N2O4 — CID 88589779
(2S)-2-amino-3-(7-amino-2-oxochromen-4-yl)propanoic acid (PubChem CID 88589779) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is (2S)-2-amino-3-(7-amino-2-oxochromen-4-yl)propanoic acid.
| Compound Name | (2S)-2-amino-3-(7-amino-2-oxochromen-4-yl)propanoic acid |
|---|---|
| PubChem CID | 88589779 |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | (2S)-2-amino-3-(7-amino-2-oxochromen-4-yl)propanoic acid |
| SMILES | Nc1ccc2c(C[C@H](N)C(=O)O)cc(=O)oc2c1 |
| InChI | InChI=1S/C12H12N2O4/c13-7-1-2-8-6(3-9(14)12(16)17)4-11(15)18-10(8)5-7/h1-2,4-5,9H,3,13-14H2,(H,16,17)/t9-/m0/s1 |
| InChIKey | LWBOYUBIVSOFOU-VIFPVBQESA-N |
| XLogP | 0.33 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|