About 7-aminochromen-2-one;(2S)-2-aminopropanoic acid
7-aminochromen-2-one;(2S)-2-aminopropanoic acid (PubChem CID 87395737) has the molecular formula C12H14N2O4
and a molecular weight of 250.25 g/mol. Its IUPAC name is 7-aminochromen-2-one;(2S)-2-aminopropanoic acid.
Molecular Properties
| Compound Name | 7-aminochromen-2-one;(2S)-2-aminopropanoic acid |
| PubChem CID | 87395737 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 7-aminochromen-2-one;(2S)-2-aminopropanoic acid |
| SMILES | C[C@H](N)C(=O)O.Nc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C9H7NO2.C3H7NO2/c10-7-3-1-6-2-4-9(11)12-8(6)5-7;1-2(4)3(5)6/h1-5H,10H2;2H,4H2,1H3,(H,5,6)/t;2-/m.0/s1 |
| InChIKey | QFWTZRWXMTZBRG-WNQIDUERSA-N |
| XLogP | 0.79 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 7-aminochromen-2-one;(2S)-2-aminopropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-aminochromen-2-one;(2S)-2-aminopropanoic acid?
The IUPAC name of 7-aminochromen-2-one;(2S)-2-aminopropanoic acid (CID 87395737) is 7-aminochromen-2-one;(2S)-2-aminopropanoic acid.
What is the SMILES notation for 7-aminochromen-2-one;(2S)-2-aminopropanoic acid?
The canonical SMILES for 7-aminochromen-2-one;(2S)-2-aminopropanoic acid is C[C@H](N)C(=O)O.Nc1ccc2ccc(=O)oc2c1.
What is the InChIKey of 7-aminochromen-2-one;(2S)-2-aminopropanoic acid?
The InChIKey is QFWTZRWXMTZBRG-WNQIDUERSA-N. The full InChI is InChI=1S/C9H7NO2.C3H7NO2/c10-7-3-1-6-2-4-9(11)12-8(6)5-7;1-2(4)3(5)6/h1-5H,10H2;2H,4H2,1H3,(H,5,6)/t;2-/m.0/s1.
What are the key properties of 7-aminochromen-2-one;(2S)-2-aminopropanoic acid?
7-aminochromen-2-one;(2S)-2-aminopropanoic acid has a molecular weight of 250.25 g/mol, XLogP of 0.79, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-aminochromen-2-one;(2S)-2-aminopropanoic acid is sourced from PubChem (CID 87395737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).