About 7-aminochromen-2-one;ethoxyethane
7-aminochromen-2-one;ethoxyethane (PubChem CID 174580965) has the molecular formula C13H17NO3
and a molecular weight of 235.28 g/mol. Its IUPAC name is 7-aminochromen-2-one;ethoxyethane.
Molecular Properties
| Compound Name | 7-aminochromen-2-one;ethoxyethane |
| PubChem CID | 174580965 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 7-aminochromen-2-one;ethoxyethane |
| SMILES | CCOCC.Nc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C9H7NO2.C4H10O/c10-7-3-1-6-2-4-9(11)12-8(6)5-7;1-3-5-4-2/h1-5H,10H2;3-4H2,1-2H3 |
| InChIKey | PZJRZBWGVDGZGN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 7-aminochromen-2-one;ethoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-aminochromen-2-one;ethoxyethane?
The IUPAC name of 7-aminochromen-2-one;ethoxyethane (CID 174580965) is 7-aminochromen-2-one;ethoxyethane.
What is the SMILES notation for 7-aminochromen-2-one;ethoxyethane?
The canonical SMILES for 7-aminochromen-2-one;ethoxyethane is CCOCC.Nc1ccc2ccc(=O)oc2c1.
What is the InChIKey of 7-aminochromen-2-one;ethoxyethane?
The InChIKey is PZJRZBWGVDGZGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2.C4H10O/c10-7-3-1-6-2-4-9(11)12-8(6)5-7;1-3-5-4-2/h1-5H,10H2;3-4H2,1-2H3.
What are the key properties of 7-aminochromen-2-one;ethoxyethane?
7-aminochromen-2-one;ethoxyethane has a molecular weight of 235.28 g/mol, XLogP of 2.42, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-aminochromen-2-one;ethoxyethane is sourced from PubChem (CID 174580965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).