About 7-aminochromen-2-one;ethane
7-aminochromen-2-one;ethane (PubChem CID 166456004) has the molecular formula C15H25NO2
and a molecular weight of 251.37 g/mol. Its IUPAC name is 7-aminochromen-2-one;ethane.
Molecular Properties
| Compound Name | 7-aminochromen-2-one;ethane |
| PubChem CID | 166456004 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 7-aminochromen-2-one;ethane |
| SMILES | CC.CC.CC.Nc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C9H7NO2.3C2H6/c10-7-3-1-6-2-4-9(11)12-8(6)5-7;3*1-2/h1-5H,10H2;3*1-2H3 |
| InChIKey | HOLVCXIHIDMQIG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 7-aminochromen-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-aminochromen-2-one;ethane?
The IUPAC name of 7-aminochromen-2-one;ethane (CID 166456004) is 7-aminochromen-2-one;ethane.
What is the SMILES notation for 7-aminochromen-2-one;ethane?
The canonical SMILES for 7-aminochromen-2-one;ethane is CC.CC.CC.Nc1ccc2ccc(=O)oc2c1.
What is the InChIKey of 7-aminochromen-2-one;ethane?
The InChIKey is HOLVCXIHIDMQIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2.3C2H6/c10-7-3-1-6-2-4-9(11)12-8(6)5-7;3*1-2/h1-5H,10H2;3*1-2H3.
What are the key properties of 7-aminochromen-2-one;ethane?
7-aminochromen-2-one;ethane has a molecular weight of 251.37 g/mol, XLogP of 4.45, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-aminochromen-2-one;ethane is sourced from PubChem (CID 166456004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).