C13H14O2 — CID 90255356
6,7-diethylchromen-2-one (PubChem CID 90255356) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is 6,7-diethylchromen-2-one.
| Compound Name | 6,7-diethylchromen-2-one |
|---|---|
| PubChem CID | 90255356 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 6,7-diethylchromen-2-one |
| SMILES | CCc1cc2ccc(=O)oc2cc1CC |
| InChI | InChI=1S/C13H14O2/c1-3-9-7-11-5-6-13(14)15-12(11)8-10(9)4-2/h5-8H,3-4H2,1-2H3 |
| InChIKey | DPFXPVWRPVKPDT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|