About 6,7-dihydroxychromen-2-one;phosphane
6,7-dihydroxychromen-2-one;phosphane (PubChem CID 175526881) has the molecular formula C9H9O4P
and a molecular weight of 212.14 g/mol. Its IUPAC name is 6,7-dihydroxychromen-2-one;phosphane.
Molecular Properties
| Compound Name | 6,7-dihydroxychromen-2-one;phosphane |
| PubChem CID | 175526881 |
| Molecular Formula | C9H9O4P |
| Molecular Weight | 212.14 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | 6,7-dihydroxychromen-2-one;phosphane |
| SMILES | O=c1ccc2cc(O)c(O)cc2o1.P |
| InChI | InChI=1S/C9H6O4.H3P/c10-6-3-5-1-2-9(12)13-8(5)4-7(6)11;/h1-4,10-11H;1H3 |
| InChIKey | QSVJPSBWKVYYAX-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.14 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 6,7-dihydroxychromen-2-one;phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydroxychromen-2-one;phosphane?
The IUPAC name of 6,7-dihydroxychromen-2-one;phosphane (CID 175526881) is 6,7-dihydroxychromen-2-one;phosphane.
What is the SMILES notation for 6,7-dihydroxychromen-2-one;phosphane?
The canonical SMILES for 6,7-dihydroxychromen-2-one;phosphane is O=c1ccc2cc(O)c(O)cc2o1.P.
What is the InChIKey of 6,7-dihydroxychromen-2-one;phosphane?
The InChIKey is QSVJPSBWKVYYAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O4.H3P/c10-6-3-5-1-2-9(12)13-8(5)4-7(6)11;/h1-4,10-11H;1H3.
What are the key properties of 6,7-dihydroxychromen-2-one;phosphane?
6,7-dihydroxychromen-2-one;phosphane has a molecular weight of 212.14 g/mol, XLogP of 1.26, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydroxychromen-2-one;phosphane is sourced from PubChem (CID 175526881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).