About 7-sulfanylchromen-2-one;hydrobromide
7-sulfanylchromen-2-one;hydrobromide (PubChem CID 173228168) has the molecular formula C9H7BrO2S
and a molecular weight of 259.12 g/mol. Its IUPAC name is 7-sulfanylchromen-2-one;hydrobromide.
Molecular Properties
| Compound Name | 7-sulfanylchromen-2-one;hydrobromide |
| PubChem CID | 173228168 |
| Molecular Formula | C9H7BrO2S |
| Molecular Weight | 259.12 g/mol |
| Exact Mass | 257.94 |
| IUPAC Name | 7-sulfanylchromen-2-one;hydrobromide |
| SMILES | Br.O=c1ccc2ccc(S)cc2o1 |
| InChI | InChI=1S/C9H6O2S.BrH/c10-9-4-2-6-1-3-7(12)5-8(6)11-9;/h1-5,12H;1H |
| InChIKey | WSTANZVZIFVQGQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 30.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.12 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 7-sulfanylchromen-2-one;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-sulfanylchromen-2-one;hydrobromide?
The IUPAC name of 7-sulfanylchromen-2-one;hydrobromide (CID 173228168) is 7-sulfanylchromen-2-one;hydrobromide.
What is the SMILES notation for 7-sulfanylchromen-2-one;hydrobromide?
The canonical SMILES for 7-sulfanylchromen-2-one;hydrobromide is Br.O=c1ccc2ccc(S)cc2o1.
What is the InChIKey of 7-sulfanylchromen-2-one;hydrobromide?
The InChIKey is WSTANZVZIFVQGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O2S.BrH/c10-9-4-2-6-1-3-7(12)5-8(6)11-9;/h1-5,12H;1H.
What are the key properties of 7-sulfanylchromen-2-one;hydrobromide?
7-sulfanylchromen-2-one;hydrobromide has a molecular weight of 259.12 g/mol, XLogP of 2.66, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-sulfanylchromen-2-one;hydrobromide is sourced from PubChem (CID 173228168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).