C15H20N2O4 — CID 118237796
chromen-2-one;2,6-diaminohexanoic acid (PubChem CID 118237796) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is chromen-2-one;2,6-diaminohexanoic acid.
| Compound Name | chromen-2-one;2,6-diaminohexanoic acid |
|---|---|
| PubChem CID | 118237796 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | chromen-2-one;2,6-diaminohexanoic acid |
| SMILES | NCCCCC(N)C(=O)O.O=c1ccc2ccccc2o1 |
| InChI | InChI=1S/C9H6O2.C6H14N2O2/c10-9-6-5-7-3-1-2-4-8(7)11-9;7-4-2-1-3-5(8)6(9)10/h1-6H;5H,1-4,7-8H2,(H,9,10) |
| InChIKey | AIXRHBLCJKRVLG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|