C22H35N3O6 — CID 174593861
7-amino-4-methylchromen-2-one;bis(2-amino-4-methylpentanoic acid) (PubChem CID 174593861) has the molecular formula C22H35N3O6 and a molecular weight of 437.54 g/mol. Its IUPAC name is 7-amino-4-methylchromen-2-one;bis(2-amino-4-methylpentanoic acid).
| Compound Name | 7-amino-4-methylchromen-2-one;bis(2-amino-4-methylpentanoic acid) |
|---|---|
| PubChem CID | 174593861 |
| Molecular Formula | C22H35N3O6 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | 7-amino-4-methylchromen-2-one;bis(2-amino-4-methylpentanoic acid) |
| SMILES | CC(C)CC(N)C(=O)O.CC(C)CC(N)C(=O)O.Cc1cc(=O)oc2cc(N)ccc12 |
| InChI | InChI=1S/C10H9NO2.2C6H13NO2/c1-6-4-10(12)13-9-5-7(11)2-3-8(6)9;2*1-4(2)3-5(7)6(8)9/h2-5H,11H2,1H3;2*4-5H,3,7H2,1-2H3,(H,8,9) |
| InChIKey | AOISZZVTMVNCSE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 182.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|