C13H12FNO5 — CID 102235108
2-amino-4-(6-fluoro-7-hydroxy-2-oxochromen-4-yl)butanoic acid (PubChem CID 102235108) has the molecular formula C13H12FNO5 and a molecular weight of 281.24 g/mol. Its IUPAC name is 2-amino-4-(6-fluoro-7-hydroxy-2-oxochromen-4-yl)butanoic acid.
| Compound Name | 2-amino-4-(6-fluoro-7-hydroxy-2-oxochromen-4-yl)butanoic acid |
|---|---|
| PubChem CID | 102235108 |
| Molecular Formula | C13H12FNO5 |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 2-amino-4-(6-fluoro-7-hydroxy-2-oxochromen-4-yl)butanoic acid |
| SMILES | NC(CCc1cc(=O)oc2cc(O)c(F)cc12)C(=O)O |
| InChI | InChI=1S/C13H12FNO5/c14-8-4-7-6(1-2-9(15)13(18)19)3-12(17)20-11(7)5-10(8)16/h3-5,9,16H,1-2,15H2,(H,18,19) |
| InChIKey | KQBLKERCHCZENV-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|