C12H11ClNO5+ — CID 102072648
[(1S)-1-carboxy-2-(6-chloro-7-hydroxy-2-oxochromen-4-yl)ethyl]azanium (PubChem CID 102072648) has the molecular formula C12H11ClNO5+ and a molecular weight of 284.68 g/mol. Its IUPAC name is [(1S)-1-carboxy-2-(6-chloro-7-hydroxy-2-oxochromen-4-yl)ethyl]azanium.
| Compound Name | [(1S)-1-carboxy-2-(6-chloro-7-hydroxy-2-oxochromen-4-yl)ethyl]azanium |
|---|---|
| PubChem CID | 102072648 |
| Molecular Formula | C12H11ClNO5+ |
| Molecular Weight | 284.68 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | [(1S)-1-carboxy-2-(6-chloro-7-hydroxy-2-oxochromen-4-yl)ethyl]azanium |
| SMILES | [NH3+][C@@H](Cc1cc(=O)oc2cc(O)c(Cl)cc12)C(=O)O |
| InChI | InChI=1S/C12H10ClNO5/c13-7-3-6-5(1-8(14)12(17)18)2-11(16)19-10(6)4-9(7)15/h2-4,8,15H,1,14H2,(H,17,18)/p+1/t8-/m0/s1 |
| InChIKey | XHSMCLYNMSUUBM-QMMMGPOBSA-O |
| XLogP | 0.39 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.68 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|