C11H9ClO3 — CID 15482447
6-chloro-7-hydroxy-2,3-dimethylchromen-4-one (PubChem CID 15482447) has the molecular formula C11H9ClO3 and a molecular weight of 224.64 g/mol. Its IUPAC name is 6-chloro-7-hydroxy-2,3-dimethylchromen-4-one.
| Compound Name | 6-chloro-7-hydroxy-2,3-dimethylchromen-4-one |
|---|---|
| PubChem CID | 15482447 |
| Molecular Formula | C11H9ClO3 |
| Molecular Weight | 224.64 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 6-chloro-7-hydroxy-2,3-dimethylchromen-4-one |
| SMILES | Cc1oc2cc(O)c(Cl)cc2c(=O)c1C |
| InChI | InChI=1S/C11H9ClO3/c1-5-6(2)15-10-4-9(13)8(12)3-7(10)11(5)14/h3-4,13H,1-2H3 |
| InChIKey | HWARGFCPSCKZFZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.64 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |