C9H4Cl2O3 — CID 54738246
6,7-dichloro-4-hydroxychromen-2-one (PubChem CID 54738246) has the molecular formula C9H4Cl2O3 and a molecular weight of 231.03 g/mol. Its IUPAC name is 6,7-dichloro-4-hydroxychromen-2-one.
| Compound Name | 6,7-dichloro-4-hydroxychromen-2-one |
|---|---|
| PubChem CID | 54738246 |
| Molecular Formula | C9H4Cl2O3 |
| Molecular Weight | 231.03 g/mol |
| Exact Mass | 229.95 |
| IUPAC Name | 6,7-dichloro-4-hydroxychromen-2-one |
| SMILES | O=c1cc(O)c2cc(Cl)c(Cl)cc2o1 |
| InChI | InChI=1S/C9H4Cl2O3/c10-5-1-4-7(12)3-9(13)14-8(4)2-6(5)11/h1-3,12H |
| InChIKey | ZNGOQLZHFHRBBZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.03 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|