C9H3BrCl2O2 — CID 177310536
7-bromo-4,6-dichlorochromen-2-one (PubChem CID 177310536) has the molecular formula C9H3BrCl2O2 and a molecular weight of 293.93 g/mol. Its IUPAC name is 7-bromo-4,6-dichlorochromen-2-one.
| Compound Name | 7-bromo-4,6-dichlorochromen-2-one |
|---|---|
| PubChem CID | 177310536 |
| Molecular Formula | C9H3BrCl2O2 |
| Molecular Weight | 293.93 g/mol |
| Exact Mass | 291.87 |
| IUPAC Name | 7-bromo-4,6-dichlorochromen-2-one |
| SMILES | O=c1cc(Cl)c2cc(Cl)c(Br)cc2o1 |
| InChI | InChI=1S/C9H3BrCl2O2/c10-5-2-8-4(1-7(5)12)6(11)3-9(13)14-8/h1-3H |
| InChIKey | IMSQBPPFCVJGAQ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.93 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|