C15H6Cl4O3 — CID 86186569
6,7-dichloro-4-(2,6-dichlorophenoxy)chromen-2-one (PubChem CID 86186569) has the molecular formula C15H6Cl4O3 and a molecular weight of 376.02 g/mol. Its IUPAC name is 6,7-dichloro-4-(2,6-dichlorophenoxy)chromen-2-one.
| Compound Name | 6,7-dichloro-4-(2,6-dichlorophenoxy)chromen-2-one |
|---|---|
| PubChem CID | 86186569 |
| Molecular Formula | C15H6Cl4O3 |
| Molecular Weight | 376.02 g/mol |
| Exact Mass | 373.91 |
| IUPAC Name | 6,7-dichloro-4-(2,6-dichlorophenoxy)chromen-2-one |
| SMILES | O=c1cc(Oc2c(Cl)cccc2Cl)c2cc(Cl)c(Cl)cc2o1 |
| InChI | InChI=1S/C15H6Cl4O3/c16-8-2-1-3-9(17)15(8)22-13-6-14(20)21-12-5-11(19)10(18)4-7(12)13/h1-6H |
| InChIKey | OZBVJNHGAQNDLG-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.02 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|