C19H16Cl2O4 — CID 86186497
6-butan-2-yloxy-4-(2,6-dichlorophenoxy)chromen-2-one (PubChem CID 86186497) has the molecular formula C19H16Cl2O4 and a molecular weight of 379.24 g/mol. Its IUPAC name is 6-butan-2-yloxy-4-(2,6-dichlorophenoxy)chromen-2-one.
| Compound Name | 6-butan-2-yloxy-4-(2,6-dichlorophenoxy)chromen-2-one |
|---|---|
| PubChem CID | 86186497 |
| Molecular Formula | C19H16Cl2O4 |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 6-butan-2-yloxy-4-(2,6-dichlorophenoxy)chromen-2-one |
| SMILES | CCC(C)Oc1ccc2oc(=O)cc(Oc3c(Cl)cccc3Cl)c2c1 |
| InChI | InChI=1S/C19H16Cl2O4/c1-3-11(2)23-12-7-8-16-13(9-12)17(10-18(22)24-16)25-19-14(20)5-4-6-15(19)21/h4-11H,3H2,1-2H3 |
| InChIKey | QZMIYZMAJPPDTE-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|