C11H8O6 — CID 53231346
6,7-dihydroxy-3-methyl-4-oxochromene-2-carboxylic acid (PubChem CID 53231346) has the molecular formula C11H8O6 and a molecular weight of 236.18 g/mol. Its IUPAC name is 6,7-dihydroxy-3-methyl-4-oxochromene-2-carboxylic acid.
| Compound Name | 6,7-dihydroxy-3-methyl-4-oxochromene-2-carboxylic acid |
|---|---|
| PubChem CID | 53231346 |
| Molecular Formula | C11H8O6 |
| Molecular Weight | 236.18 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | 6,7-dihydroxy-3-methyl-4-oxochromene-2-carboxylic acid |
| SMILES | Cc1c(C(=O)O)oc2cc(O)c(O)cc2c1=O |
| InChI | InChI=1S/C11H8O6/c1-4-9(14)5-2-6(12)7(13)3-8(5)17-10(4)11(15)16/h2-3,12-13H,1H3,(H,15,16) |
| InChIKey | GNXUGJHNPVHLFE-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.18 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|