C14H9O6- — CID 143807466
3,6,7-trihydroxy-2-methyl-9-oxoxanthen-1-olate (PubChem CID 143807466) has the molecular formula C14H9O6- and a molecular weight of 273.22 g/mol. Its IUPAC name is 3,6,7-trihydroxy-2-methyl-9-oxoxanthen-1-olate.
| Compound Name | 3,6,7-trihydroxy-2-methyl-9-oxoxanthen-1-olate |
|---|---|
| PubChem CID | 143807466 |
| Molecular Formula | C14H9O6- |
| Molecular Weight | 273.22 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 3,6,7-trihydroxy-2-methyl-9-oxoxanthen-1-olate |
| SMILES | Cc1c(O)cc2oc3cc(O)c(O)cc3c(=O)c2c1[O-] |
| InChI | InChI=1S/C14H10O6/c1-5-7(15)3-11-12(13(5)18)14(19)6-2-8(16)9(17)4-10(6)20-11/h2-4,15-18H,1H3/p-1 |
| InChIKey | IZVQTVISHICKOL-UHFFFAOYSA-M |
| XLogP | 1.45 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|