C13H8O5 — CID 14528805
2,3,7-trihydroxyxanthen-9-one (PubChem CID 14528805) has the molecular formula C13H8O5 and a molecular weight of 244.20 g/mol. Its IUPAC name is 2,3,7-trihydroxyxanthen-9-one.
| Compound Name | 2,3,7-trihydroxyxanthen-9-one |
|---|---|
| PubChem CID | 14528805 |
| Molecular Formula | C13H8O5 |
| Molecular Weight | 244.20 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 2,3,7-trihydroxyxanthen-9-one |
| SMILES | O=c1c2cc(O)ccc2oc2cc(O)c(O)cc12 |
| InChI | InChI=1S/C13H8O5/c14-6-1-2-11-7(3-6)13(17)8-4-9(15)10(16)5-12(8)18-11/h1-5,14-16H |
| InChIKey | UEGGYHBZJXMZJI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.20 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|