C11H10O4 — CID 102497049
4,6-dihydroxy-3,7-dimethylchromen-2-one (PubChem CID 102497049) has the molecular formula C11H10O4 and a molecular weight of 206.20 g/mol. Its IUPAC name is 4,6-dihydroxy-3,7-dimethylchromen-2-one.
| Compound Name | 4,6-dihydroxy-3,7-dimethylchromen-2-one |
|---|---|
| PubChem CID | 102497049 |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 4,6-dihydroxy-3,7-dimethylchromen-2-one |
| SMILES | Cc1cc2oc(=O)c(C)c(O)c2cc1O |
| InChI | InChI=1S/C11H10O4/c1-5-3-9-7(4-8(5)12)10(13)6(2)11(14)15-9/h3-4,12-13H,1-2H3 |
| InChIKey | ZJTMROMSCIWWOV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|