C12H12O3 — CID 90143254
1-(3-hydroxy-5,6-dimethyl-1-benzofuran-2-yl)ethanone (PubChem CID 90143254) has the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. Its IUPAC name is 1-(3-hydroxy-5,6-dimethyl-1-benzofuran-2-yl)ethanone.
| Compound Name | 1-(3-hydroxy-5,6-dimethyl-1-benzofuran-2-yl)ethanone |
|---|---|
| PubChem CID | 90143254 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 1-(3-hydroxy-5,6-dimethyl-1-benzofuran-2-yl)ethanone |
| SMILES | CC(=O)c1oc2cc(C)c(C)cc2c1O |
| InChI | InChI=1S/C12H12O3/c1-6-4-9-10(5-7(6)2)15-12(8(3)13)11(9)14/h4-5,14H,1-3H3 |
| InChIKey | LPKPLMWCHMOPGW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |