C10H8O5 — CID 156582420
3,4,7-trihydroxy-6-methylchromen-2-one (PubChem CID 156582420) has the molecular formula C10H8O5 and a molecular weight of 208.17 g/mol. Its IUPAC name is 3,4,7-trihydroxy-6-methylchromen-2-one.
| Compound Name | 3,4,7-trihydroxy-6-methylchromen-2-one |
|---|---|
| PubChem CID | 156582420 |
| Molecular Formula | C10H8O5 |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 3,4,7-trihydroxy-6-methylchromen-2-one |
| SMILES | Cc1cc2c(O)c(O)c(=O)oc2cc1O |
| InChI | InChI=1S/C10H8O5/c1-4-2-5-7(3-6(4)11)15-10(14)9(13)8(5)12/h2-3,11-13H,1H3 |
| InChIKey | VMYHWWAOAVUGLS-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|