7-hydroxy-3,4-dimethyl-2-oxochromene-6-sulfonyl chloride

C11H9ClO5S — CID 121006290

IUPAC7-hydroxy-3,4-dimethyl-2-oxochromene-6-sulfonyl chloride
SMILESCc1c(C)c2cc(S(=O)(=O)Cl)c(O)cc2oc1=O
InChIInChI=1S/C11H9ClO5S/c1-5-6(2)11(14)17-9-4-8(13)10(3-7(5)9)18(12,15)16/h3-4,13H,1-2H3
InChIKeyANFQXRCOZRVFRC-UHFFFAOYSA-N
MW288.71 g/mol
LogP2.04
Rot. Bonds1

About 7-hydroxy-3,4-dimethyl-2-oxochromene-6-sulfonyl chloride

7-hydroxy-3,4-dimethyl-2-oxochromene-6-sulfonyl chloride (PubChem CID 121006290) has the molecular formula C11H9ClO5S and a molecular weight of 288.71 g/mol. Its IUPAC name is 7-hydroxy-3,4-dimethyl-2-oxochromene-6-sulfonyl chloride.

Molecular Properties

Compound Name7-hydroxy-3,4-dimethyl-2-oxochromene-6-sulfonyl chloride
PubChem CID121006290
Molecular FormulaC11H9ClO5S
Molecular Weight288.71 g/mol
Exact Mass287.99
IUPAC Name7-hydroxy-3,4-dimethyl-2-oxochromene-6-sulfonyl chloride
SMILESCc1c(C)c2cc(S(=O)(=O)Cl)c(O)cc2oc1=O
InChIInChI=1S/C11H9ClO5S/c1-5-6(2)11(14)17-9-4-8(13)10(3-7(5)9)18(12,15)16/h3-4,13H,1-2H3
InChIKeyANFQXRCOZRVFRC-UHFFFAOYSA-N
XLogP2.04
TPSA84.58 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500288.71
LogP ≤ 52.04
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'cumarine', 'substructure': 'N/A'}

Analyze 7-hydroxy-3,4-dimethyl-2-oxochromene-6-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-hydroxy-3,4-dimethyl-2-oxochromene-6-sulfonyl chloride?
The IUPAC name of 7-hydroxy-3,4-dimethyl-2-oxochromene-6-sulfonyl chloride (CID 121006290) is 7-hydroxy-3,4-dimethyl-2-oxochromene-6-sulfonyl chloride.
What is the SMILES notation for 7-hydroxy-3,4-dimethyl-2-oxochromene-6-sulfonyl chloride?
The canonical SMILES for 7-hydroxy-3,4-dimethyl-2-oxochromene-6-sulfonyl chloride is Cc1c(C)c2cc(S(=O)(=O)Cl)c(O)cc2oc1=O.
What is the InChIKey of 7-hydroxy-3,4-dimethyl-2-oxochromene-6-sulfonyl chloride?
The InChIKey is ANFQXRCOZRVFRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9ClO5S/c1-5-6(2)11(14)17-9-4-8(13)10(3-7(5)9)18(12,15)16/h3-4,13H,1-2H3.
What are the key properties of 7-hydroxy-3,4-dimethyl-2-oxochromene-6-sulfonyl chloride?
7-hydroxy-3,4-dimethyl-2-oxochromene-6-sulfonyl chloride has a molecular weight of 288.71 g/mol, XLogP of 2.04, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-3,4-dimethyl-2-oxochromene-6-sulfonyl chloride is sourced from PubChem (CID 121006290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).