C11H9ClO5S — CID 121006290
7-hydroxy-3,4-dimethyl-2-oxochromene-6-sulfonyl chloride (PubChem CID 121006290) has the molecular formula C11H9ClO5S and a molecular weight of 288.71 g/mol. Its IUPAC name is 7-hydroxy-3,4-dimethyl-2-oxochromene-6-sulfonyl chloride.
| Compound Name | 7-hydroxy-3,4-dimethyl-2-oxochromene-6-sulfonyl chloride |
|---|---|
| PubChem CID | 121006290 |
| Molecular Formula | C11H9ClO5S |
| Molecular Weight | 288.71 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | 7-hydroxy-3,4-dimethyl-2-oxochromene-6-sulfonyl chloride |
| SMILES | Cc1c(C)c2cc(S(=O)(=O)Cl)c(O)cc2oc1=O |
| InChI | InChI=1S/C11H9ClO5S/c1-5-6(2)11(14)17-9-4-8(13)10(3-7(5)9)18(12,15)16/h3-4,13H,1-2H3 |
| InChIKey | ANFQXRCOZRVFRC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.71 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|