C15H10F2O4 — CID 167659891
2-(1,1-difluoroethyl)-3,8-dihydroxybenzo[c]chromen-6-one (PubChem CID 167659891) has the molecular formula C15H10F2O4 and a molecular weight of 292.24 g/mol. Its IUPAC name is 2-(1,1-difluoroethyl)-3,8-dihydroxybenzo[c]chromen-6-one.
| Compound Name | 2-(1,1-difluoroethyl)-3,8-dihydroxybenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 167659891 |
| Molecular Formula | C15H10F2O4 |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 2-(1,1-difluoroethyl)-3,8-dihydroxybenzo[c]chromen-6-one |
| SMILES | CC(F)(F)c1cc2c(cc1O)oc(=O)c1cc(O)ccc12 |
| InChI | InChI=1S/C15H10F2O4/c1-15(16,17)11-5-9-8-3-2-7(18)4-10(8)14(20)21-13(9)6-12(11)19/h2-6,18-19H,1H3 |
| InChIKey | VXMSPDDFTIMWJI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|