C28H26O4 — CID 122227213
6,17-ditert-butyl-11,22-dioxapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(14),2,4(9),5,7,12,15(20),16,18-nonaene-10,21-dione (PubChem CID 122227213) has the molecular formula C28H26O4 and a molecular weight of 426.51 g/mol. Its IUPAC name is 6,17-ditert-butyl-11,22-dioxapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(14),2,4(9),5,7,12,15(20),16,18-nonaene-10,21-dione.
| Compound Name | 6,17-ditert-butyl-11,22-dioxapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(14),2,4(9),5,7,12,15(20),16,18-nonaene-10,21-dione |
|---|---|
| PubChem CID | 122227213 |
| Molecular Formula | C28H26O4 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 6,17-ditert-butyl-11,22-dioxapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(14),2,4(9),5,7,12,15(20),16,18-nonaene-10,21-dione |
| SMILES | CC(C)(C)c1ccc2c(=O)oc3cc4c(cc3c2c1)oc(=O)c1ccc(C(C)(C)C)cc14 |
| InChI | InChI=1S/C28H26O4/c1-27(2,3)15-7-9-17-19(11-15)21-13-24-22(14-23(21)31-25(17)29)20-12-16(28(4,5)6)8-10-18(20)26(30)32-24/h7-14H,1-6H3 |
| InChIKey | FYNMGQPLWFKXDX-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|