About 7-(trifluoromethyl)-1,3-benzodioxine-2,4-dione
7-(trifluoromethyl)-1,3-benzodioxine-2,4-dione (PubChem CID 23731268) has the molecular formula C9H3F3O4
and a molecular weight of 232.11 g/mol. Its IUPAC name is 7-(trifluoromethyl)-1,3-benzodioxine-2,4-dione.
Molecular Properties
| Compound Name | 7-(trifluoromethyl)-1,3-benzodioxine-2,4-dione |
| PubChem CID | 23731268 |
| Molecular Formula | C9H3F3O4 |
| Molecular Weight | 232.11 g/mol |
| Exact Mass | 232.00 |
| IUPAC Name | 7-(trifluoromethyl)-1,3-benzodioxine-2,4-dione |
| SMILES | O=c1oc(=O)c2ccc(C(F)(F)F)cc2o1 |
| InChI | InChI=1S/C9H3F3O4/c10-9(11,12)4-1-2-5-6(3-4)15-8(14)16-7(5)13/h1-3H |
| InChIKey | PEABZWRZQAMQQT-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.11 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-(trifluoromethyl)-1,3-benzodioxine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(trifluoromethyl)-1,3-benzodioxine-2,4-dione?
The IUPAC name of 7-(trifluoromethyl)-1,3-benzodioxine-2,4-dione (CID 23731268) is 7-(trifluoromethyl)-1,3-benzodioxine-2,4-dione.
What is the SMILES notation for 7-(trifluoromethyl)-1,3-benzodioxine-2,4-dione?
The canonical SMILES for 7-(trifluoromethyl)-1,3-benzodioxine-2,4-dione is O=c1oc(=O)c2ccc(C(F)(F)F)cc2o1.
What is the InChIKey of 7-(trifluoromethyl)-1,3-benzodioxine-2,4-dione?
The InChIKey is PEABZWRZQAMQQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H3F3O4/c10-9(11,12)4-1-2-5-6(3-4)15-8(14)16-7(5)13/h1-3H.
What are the key properties of 7-(trifluoromethyl)-1,3-benzodioxine-2,4-dione?
7-(trifluoromethyl)-1,3-benzodioxine-2,4-dione has a molecular weight of 232.11 g/mol, XLogP of 1.76, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(trifluoromethyl)-1,3-benzodioxine-2,4-dione is sourced from PubChem (CID 23731268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).