C9H3F3O4 — CID 23731268
7-(trifluoromethyl)-1,3-benzodioxine-2,4-dione (PubChem CID 23731268) has the molecular formula C9H3F3O4 and a molecular weight of 232.11 g/mol. Its IUPAC name is 7-(trifluoromethyl)-1,3-benzodioxine-2,4-dione.
| Compound Name | 7-(trifluoromethyl)-1,3-benzodioxine-2,4-dione |
|---|---|
| PubChem CID | 23731268 |
| Molecular Formula | C9H3F3O4 |
| Molecular Weight | 232.11 g/mol |
| Exact Mass | 232.00 |
| IUPAC Name | 7-(trifluoromethyl)-1,3-benzodioxine-2,4-dione |
| SMILES | O=c1oc(=O)c2ccc(C(F)(F)F)cc2o1 |
| InChI | InChI=1S/C9H3F3O4/c10-9(11,12)4-1-2-5-6(3-4)15-8(14)16-7(5)13/h1-3H |
| InChIKey | PEABZWRZQAMQQT-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.11 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |