C19H8F6O2 — CID 135178908
3,8-bis(trifluoromethyl)benzo[b]xanthen-12-one (PubChem CID 135178908) has the molecular formula C19H8F6O2 and a molecular weight of 382.26 g/mol. Its IUPAC name is 3,8-bis(trifluoromethyl)benzo[b]xanthen-12-one.
| Compound Name | 3,8-bis(trifluoromethyl)benzo[b]xanthen-12-one |
|---|---|
| PubChem CID | 135178908 |
| Molecular Formula | C19H8F6O2 |
| Molecular Weight | 382.26 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 3,8-bis(trifluoromethyl)benzo[b]xanthen-12-one |
| SMILES | O=c1c2ccc(C(F)(F)F)cc2oc2cc3cc(C(F)(F)F)ccc3cc12 |
| InChI | InChI=1S/C19H8F6O2/c20-18(21,22)11-2-1-9-6-14-15(7-10(9)5-11)27-16-8-12(19(23,24)25)3-4-13(16)17(14)26/h1-8H |
| InChIKey | OYDJROOECSTLPQ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.26 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|