C11H5F3O3 — CID 177405873
6-(trifluoromethyl)-3H-furo[3,4-b][1]benzofuran-1-one (PubChem CID 177405873) has the molecular formula C11H5F3O3 and a molecular weight of 242.15 g/mol. Its IUPAC name is 6-(trifluoromethyl)-3H-furo[3,4-b][1]benzofuran-1-one.
| Compound Name | 6-(trifluoromethyl)-3H-furo[3,4-b][1]benzofuran-1-one |
|---|---|
| PubChem CID | 177405873 |
| Molecular Formula | C11H5F3O3 |
| Molecular Weight | 242.15 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | 6-(trifluoromethyl)-3H-furo[3,4-b][1]benzofuran-1-one |
| SMILES | O=C1OCc2oc3cc(C(F)(F)F)ccc3c21 |
| InChI | InChI=1S/C11H5F3O3/c12-11(13,14)5-1-2-6-7(3-5)17-8-4-16-10(15)9(6)8/h1-3H,4H2 |
| InChIKey | UIFULYXWIBYTHH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.15 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |