C14H12O9S — CID 18530356
sulfuric acid;2,6,7-trihydroxy-9-methylxanthen-3-one (PubChem CID 18530356) has the molecular formula C14H12O9S and a molecular weight of 356.31 g/mol. Its IUPAC name is sulfuric acid;2,6,7-trihydroxy-9-methylxanthen-3-one.
| Compound Name | sulfuric acid;2,6,7-trihydroxy-9-methylxanthen-3-one |
|---|---|
| PubChem CID | 18530356 |
| Molecular Formula | C14H12O9S |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | sulfuric acid;2,6,7-trihydroxy-9-methylxanthen-3-one |
| SMILES | Cc1c2cc(O)c(=O)cc-2oc2cc(O)c(O)cc12.O=S(=O)(O)O |
| InChI | InChI=1S/C14H10O5.H2O4S/c1-6-7-2-9(15)11(17)4-13(7)19-14-5-12(18)10(16)3-8(6)14;1-5(2,3)4/h2-5,15-17H,1H3;(H2,1,2,3,4) |
| InChIKey | UVWANBSDFYPPRR-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 165.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|