C20H13ClO7 — CID 21215129
9-(3-chloro-4-hydroxy-5-methoxyphenyl)-2,6,7-trihydroxyxanthen-3-one (PubChem CID 21215129) has the molecular formula C20H13ClO7 and a molecular weight of 400.77 g/mol. Its IUPAC name is 9-(3-chloro-4-hydroxy-5-methoxyphenyl)-2,6,7-trihydroxyxanthen-3-one.
| Compound Name | 9-(3-chloro-4-hydroxy-5-methoxyphenyl)-2,6,7-trihydroxyxanthen-3-one |
|---|---|
| PubChem CID | 21215129 |
| Molecular Formula | C20H13ClO7 |
| Molecular Weight | 400.77 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | 9-(3-chloro-4-hydroxy-5-methoxyphenyl)-2,6,7-trihydroxyxanthen-3-one |
| SMILES | COc1cc(-c2c3cc(O)c(=O)cc-3oc3cc(O)c(O)cc23)cc(Cl)c1O |
| InChI | InChI=1S/C20H13ClO7/c1-27-18-3-8(2-11(21)20(18)26)19-9-4-12(22)14(24)6-16(9)28-17-7-15(25)13(23)5-10(17)19/h2-7,22-24,26H,1H3 |
| InChIKey | BNMHGCIENRGTOK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.77 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|