C23H16O9 — CID 20549096
4-(3-hydroxy-2,7-dimethoxy-6-oxoxanthen-9-yl)phthalic acid (PubChem CID 20549096) has the molecular formula C23H16O9 and a molecular weight of 436.37 g/mol. Its IUPAC name is 4-(3-hydroxy-2,7-dimethoxy-6-oxoxanthen-9-yl)phthalic acid.
| Compound Name | 4-(3-hydroxy-2,7-dimethoxy-6-oxoxanthen-9-yl)phthalic acid |
|---|---|
| PubChem CID | 20549096 |
| Molecular Formula | C23H16O9 |
| Molecular Weight | 436.37 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | 4-(3-hydroxy-2,7-dimethoxy-6-oxoxanthen-9-yl)phthalic acid |
| SMILES | COc1cc2c(-c3ccc(C(=O)O)c(C(=O)O)c3)c3cc(OC)c(=O)cc-3oc2cc1O |
| InChI | InChI=1S/C23H16O9/c1-30-19-6-13-17(8-15(19)24)32-18-9-16(25)20(31-2)7-14(18)21(13)10-3-4-11(22(26)27)12(5-10)23(28)29/h3-9,24H,1-2H3,(H,26,27)(H,28,29) |
| InChIKey | CUCBPALMJJFIMJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 143.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.37 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|