C44H28O17S4 — CID 170030572
2-[3-hydroxy-6-oxo-2,7-bis[4-sulfo-2-(4-sulfophenyl)phenyl]xanthen-9-yl]benzoic acid (PubChem CID 170030572) has the molecular formula C44H28O17S4 and a molecular weight of 956.96 g/mol. Its IUPAC name is 2-[3-hydroxy-6-oxo-2,7-bis[4-sulfo-2-(4-sulfophenyl)phenyl]xanthen-9-yl]benzoic acid.
| Compound Name | 2-[3-hydroxy-6-oxo-2,7-bis[4-sulfo-2-(4-sulfophenyl)phenyl]xanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 170030572 |
| Molecular Formula | C44H28O17S4 |
| Molecular Weight | 956.96 g/mol |
| Exact Mass | 956.02 |
| IUPAC Name | 2-[3-hydroxy-6-oxo-2,7-bis[4-sulfo-2-(4-sulfophenyl)phenyl]xanthen-9-yl]benzoic acid |
| SMILES | O=C(O)c1ccccc1-c1c2cc(-c3ccc(S(=O)(=O)O)cc3-c3ccc(S(=O)(=O)O)cc3)c(=O)cc-2oc2cc(O)c(-c3ccc(S(=O)(=O)O)cc3-c3ccc(S(=O)(=O)O)cc3)cc12 |
| InChI | InChI=1S/C44H28O17S4/c45-39-21-41-37(19-35(39)29-15-13-27(64(55,56)57)17-33(29)23-5-9-25(10-6-23)62(49,50)51)43(31-3-1-2-4-32(31)44(47)48)38-20-36(40(46)22-42(38)61-41)30-16-14-28(65(58,59)60)18-34(30)24-7-11-26(12-8-24)63(52,53)54/h1-22,45H,(H,47,48)(H,49,50,51)(H,52,53,54)(H,55,56,57)(H,58,59,60) |
| InChIKey | OYESDBGGJLHVHX-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 305.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 65 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 956.96 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|