C35H25ClO7 — CID 88566914
2-[2-chloro-6-hydroxy-7-(8-methyl-15,16-dioxatetracyclo[6.6.2.02,7.09,14]hexadeca-3,5,10,12-tetraen-1-yl)-3-oxoxanthen-9-yl]benzoic acid (PubChem CID 88566914) has the molecular formula C35H25ClO7 and a molecular weight of 593.03 g/mol. Its IUPAC name is 2-[2-chloro-6-hydroxy-7-(8-methyl-15,16-dioxatetracyclo[6.6.2.02,7.09,14]hexadeca-3,5,10,12-tetraen-1-yl)-3-oxoxanthen-9-yl]benzoic acid.
| Compound Name | 2-[2-chloro-6-hydroxy-7-(8-methyl-15,16-dioxatetracyclo[6.6.2.02,7.09,14]hexadeca-3,5,10,12-tetraen-1-yl)-3-oxoxanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 88566914 |
| Molecular Formula | C35H25ClO7 |
| Molecular Weight | 593.03 g/mol |
| Exact Mass | 592.13 |
| IUPAC Name | 2-[2-chloro-6-hydroxy-7-(8-methyl-15,16-dioxatetracyclo[6.6.2.02,7.09,14]hexadeca-3,5,10,12-tetraen-1-yl)-3-oxoxanthen-9-yl]benzoic acid |
| SMILES | CC12OOC(c3cc4c(-c5ccccc5C(=O)O)c5cc(Cl)c(=O)cc-5oc4cc3O)(C3C=CC=CC31)C1C=CC=CC12 |
| InChI | InChI=1S/C35H25ClO7/c1-34-22-10-4-6-12-24(22)35(43-42-34,25-13-7-5-11-23(25)34)26-14-20-30(16-28(26)37)41-31-17-29(38)27(36)15-21(31)32(20)18-8-2-3-9-19(18)33(39)40/h2-17,22-25,37H,1H3,(H,39,40) |
| InChIKey | MDYYGJFWFNKEME-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.03 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|