C20H13Cl2NO3 — CID 142434418
9-(4-amino-2-methylphenyl)-2,7-dichloro-6-hydroxyxanthen-3-one (PubChem CID 142434418) has the molecular formula C20H13Cl2NO3 and a molecular weight of 386.23 g/mol. Its IUPAC name is 9-(4-amino-2-methylphenyl)-2,7-dichloro-6-hydroxyxanthen-3-one.
| Compound Name | 9-(4-amino-2-methylphenyl)-2,7-dichloro-6-hydroxyxanthen-3-one |
|---|---|
| PubChem CID | 142434418 |
| Molecular Formula | C20H13Cl2NO3 |
| Molecular Weight | 386.23 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 9-(4-amino-2-methylphenyl)-2,7-dichloro-6-hydroxyxanthen-3-one |
| SMILES | Cc1cc(N)ccc1-c1c2cc(Cl)c(=O)cc-2oc2cc(O)c(Cl)cc12 |
| InChI | InChI=1S/C20H13Cl2NO3/c1-9-4-10(23)2-3-11(9)20-12-5-14(21)16(24)7-18(12)26-19-8-17(25)15(22)6-13(19)20/h2-8,24H,23H2,1H3 |
| InChIKey | MGBHVAOGNGDSNF-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.23 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|