C20H9Cl2NO7 — CID 102287995
2-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-5-nitrobenzoic acid (PubChem CID 102287995) has the molecular formula C20H9Cl2NO7 and a molecular weight of 446.20 g/mol. Its IUPAC name is 2-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-5-nitrobenzoic acid.
| Compound Name | 2-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 102287995 |
| Molecular Formula | C20H9Cl2NO7 |
| Molecular Weight | 446.20 g/mol |
| Exact Mass | 444.98 |
| IUPAC Name | 2-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-5-nitrobenzoic acid |
| SMILES | O=C(O)c1cc([N+](=O)[O-])ccc1-c1c2cc(Cl)c(=O)cc-2oc2cc(O)c(Cl)cc12 |
| InChI | InChI=1S/C20H9Cl2NO7/c21-13-4-11-17(6-15(13)24)30-18-7-16(25)14(22)5-12(18)19(11)9-2-1-8(23(28)29)3-10(9)20(26)27/h1-7,24H,(H,26,27) |
| InChIKey | QTSJVQLBHMBZKJ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.20 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|